C25H33N5O3 — CID 123339043
3-[[[(1-cyclopentylindazol-4-yl)-hydroxymethyl]amino]methyl]-6-methyl-4-(morpholin-4-ylmethyl)-1H-pyridin-2-one (PubChem CID 123339043) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[[[(1-cyclopentylindazol-4-yl)-hydroxymethyl]amino]methyl]-6-methyl-4-(morpholin-4-ylmethyl)-1H-pyridin-2-one.
| Compound Name | 3-[[[(1-cyclopentylindazol-4-yl)-hydroxymethyl]amino]methyl]-6-methyl-4-(morpholin-4-ylmethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123339043 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3-[[[(1-cyclopentylindazol-4-yl)-hydroxymethyl]amino]methyl]-6-methyl-4-(morpholin-4-ylmethyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(CN2CCOCC2)c(CNC(O)c2cccc3c2cnn3C2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H33N5O3/c1-17-13-18(16-29-9-11-33-12-10-29)21(25(32)28-17)14-26-24(31)20-7-4-8-23-22(20)15-27-30(23)19-5-2-3-6-19/h4,7-8,13,15,19,24,26,31H,2-3,5-6,9-12,14,16H2,1H3,(H,28,32) |
| InChIKey | DISXGEUQLHQMCQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|