C25H33N5O2 — CID 130459738
3-(cyclopentylamino)-2-methanimidoyl-N-[[6-methyl-2-oxo-4-(pyrrolidin-1-ylmethyl)-1H-pyridin-3-yl]methyl]benzamide (PubChem CID 130459738) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-(cyclopentylamino)-2-methanimidoyl-N-[[6-methyl-2-oxo-4-(pyrrolidin-1-ylmethyl)-1H-pyridin-3-yl]methyl]benzamide.
| Compound Name | 3-(cyclopentylamino)-2-methanimidoyl-N-[[6-methyl-2-oxo-4-(pyrrolidin-1-ylmethyl)-1H-pyridin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 130459738 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-(cyclopentylamino)-2-methanimidoyl-N-[[6-methyl-2-oxo-4-(pyrrolidin-1-ylmethyl)-1H-pyridin-3-yl]methyl]benzamide |
| SMILES | [H]/N=C/c1c(NC2CCCC2)cccc1C(=O)NCc1c(CN2CCCC2)cc(C)[nH]c1=O |
| InChI | InChI=1S/C25H33N5O2/c1-17-13-18(16-30-11-4-5-12-30)22(25(32)28-17)15-27-24(31)20-9-6-10-23(21(20)14-26)29-19-7-2-3-8-19/h6,9-10,13-14,19,26,29H,2-5,7-8,11-12,15-16H2,1H3,(H,27,31)(H,28,32)/b26-14+ |
| InChIKey | UKUHHEZPRGBUNW-VULFUBBASA-N |
| XLogP | 3.56 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|