C29H32N4O3 — CID 123882195
3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-(4-formyl-2-methylphenyl)-2-methanimidoylbenzamide (PubChem CID 123882195) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-(4-formyl-2-methylphenyl)-2-methanimidoylbenzamide.
| Compound Name | 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-(4-formyl-2-methylphenyl)-2-methanimidoylbenzamide |
|---|---|
| PubChem CID | 123882195 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-(4-formyl-2-methylphenyl)-2-methanimidoylbenzamide |
| SMILES | [H]/N=C/c1c(NC2CCCC2)cc(-c2ccc(C=O)cc2C)cc1C(=O)NCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C29H32N4O3/c1-17-10-19(3)32-29(36)26(17)15-31-28(35)24-12-21(23-9-8-20(16-34)11-18(23)2)13-27(25(24)14-30)33-22-6-4-5-7-22/h8-14,16,22,30,33H,4-7,15H2,1-3H3,(H,31,35)(H,32,36)/b30-14+ |
| InChIKey | MUUARGDIJOCYJW-AMVVHIIESA-N |
| XLogP | 5.06 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|