C31H39N5O3 — CID 148682622
3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-5-[3-[3-(methylamino)propoxy]phenyl]benzamide (PubChem CID 148682622) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-5-[3-[3-(methylamino)propoxy]phenyl]benzamide.
| Compound Name | 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-5-[3-[3-(methylamino)propoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 148682622 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 3-(cyclopentylamino)-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-5-[3-[3-(methylamino)propoxy]phenyl]benzamide |
| SMILES | [H]/N=C/c1c(NC2CCCC2)cc(-c2cccc(OCCCNC)c2)cc1C(=O)NCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C31H39N5O3/c1-20-14-21(2)35-31(38)28(20)19-34-30(37)26-16-23(17-29(27(26)18-32)36-24-9-4-5-10-24)22-8-6-11-25(15-22)39-13-7-12-33-3/h6,8,11,14-18,24,32-33,36H,4-5,7,9-10,12-13,19H2,1-3H3,(H,34,37)(H,35,38)/b32-18+ |
| InChIKey | NRXOTRUJFWYIEY-KCSSXMTESA-N |
| XLogP | 4.93 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|