C21H25BrN4O3 — CID 130460089
5-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-3-(oxan-4-ylamino)benzamide (PubChem CID 130460089) has the molecular formula C21H25BrN4O3 and a molecular weight of 461.36 g/mol. Its IUPAC name is 5-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-3-(oxan-4-ylamino)benzamide.
| Compound Name | 5-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-3-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 130460089 |
| Molecular Formula | C21H25BrN4O3 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 5-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methanimidoyl-3-(oxan-4-ylamino)benzamide |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)cc(Br)cc1C(=O)NCc1c(C)cc(C)[nH]c1=O |
| InChI | InChI=1S/C21H25BrN4O3/c1-12-7-13(2)25-21(28)18(12)11-24-20(27)16-8-14(22)9-19(17(16)10-23)26-15-3-5-29-6-4-15/h7-10,15,23,26H,3-6,11H2,1-2H3,(H,24,27)(H,25,28)/b23-10+ |
| InChIKey | DHXRCYSODYELIK-AUEPDCJTSA-N |
| XLogP | 3.27 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|