C25H15F7N5+ — CID 123340196
3-[[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]methyl]-6-(2-fluorophenyl)-5H-pyrrolo[3,2-d]pyrimidin-3-ium (PubChem CID 123340196) has the molecular formula C25H15F7N5+ and a molecular weight of 518.42 g/mol. Its IUPAC name is 3-[[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]methyl]-6-(2-fluorophenyl)-5H-pyrrolo[3,2-d]pyrimidin-3-ium.
| Compound Name | 3-[[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]methyl]-6-(2-fluorophenyl)-5H-pyrrolo[3,2-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 123340196 |
| Molecular Formula | C25H15F7N5+ |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 3-[[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]methyl]-6-(2-fluorophenyl)-5H-pyrrolo[3,2-d]pyrimidin-3-ium |
| SMILES | Fc1ccccc1-c1cc2nc[n+](Cc3ccc(-c4ccc(C(F)(F)F)cc4C(F)(F)F)nn3)cc2[nH]1 |
| InChI | InChI=1S/C25H14F7N5/c26-19-4-2-1-3-17(19)21-10-22-23(34-21)12-37(13-33-22)11-15-6-8-20(36-35-15)16-7-5-14(24(27,28)29)9-18(16)25(30,31)32/h1-10,12-13H,11H2/p+1 |
| InChIKey | QQWZZGDYHHWNCG-UHFFFAOYSA-O |
| XLogP | 6.20 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|