C13H6F7N — CID 130181953
2-[2,4-bis(trifluoromethyl)phenyl]-3-fluoropyridine (PubChem CID 130181953) has the molecular formula C13H6F7N and a molecular weight of 309.18 g/mol. Its IUPAC name is 2-[2,4-bis(trifluoromethyl)phenyl]-3-fluoropyridine.
| Compound Name | 2-[2,4-bis(trifluoromethyl)phenyl]-3-fluoropyridine |
|---|---|
| PubChem CID | 130181953 |
| Molecular Formula | C13H6F7N |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-[2,4-bis(trifluoromethyl)phenyl]-3-fluoropyridine |
| SMILES | Fc1cccnc1-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H6F7N/c14-10-2-1-5-21-11(10)8-4-3-7(12(15,16)17)6-9(8)13(18,19)20/h1-6H |
| InChIKey | SXGCMGBCUGNTII-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |