C12H6F5N — CID 170837725
2-(2,3-difluorophenyl)-3-(trifluoromethyl)pyridine (PubChem CID 170837725) has the molecular formula C12H6F5N and a molecular weight of 259.18 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-3-(trifluoromethyl)pyridine.
| Compound Name | 2-(2,3-difluorophenyl)-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 170837725 |
| Molecular Formula | C12H6F5N |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-(2,3-difluorophenyl)-3-(trifluoromethyl)pyridine |
| SMILES | Fc1cccc(-c2ncccc2C(F)(F)F)c1F |
| InChI | InChI=1S/C12H6F5N/c13-9-5-1-3-7(10(9)14)11-8(12(15,16)17)4-2-6-18-11/h1-6H |
| InChIKey | YKSAODHIYHLSIC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |