C12H7BF5NO2 — CID 153320819
[2-(2,3-difluorophenyl)-3-(trifluoromethyl)-4-pyridinyl]boronic acid (PubChem CID 153320819) has the molecular formula C12H7BF5NO2 and a molecular weight of 303.00 g/mol. Its IUPAC name is [2-(2,3-difluorophenyl)-3-(trifluoromethyl)-4-pyridinyl]boronic acid.
| Compound Name | [2-(2,3-difluorophenyl)-3-(trifluoromethyl)-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 153320819 |
| Molecular Formula | C12H7BF5NO2 |
| Molecular Weight | 303.00 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | [2-(2,3-difluorophenyl)-3-(trifluoromethyl)-4-pyridinyl]boronic acid |
| SMILES | OB(O)c1ccnc(-c2cccc(F)c2F)c1C(F)(F)F |
| InChI | InChI=1S/C12H7BF5NO2/c14-8-3-1-2-6(10(8)15)11-9(12(16,17)18)7(13(20)21)4-5-19-11/h1-5,20-21H |
| InChIKey | GFZXOTXJAUCGHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.00 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|