C12H7F5N2 — CID 119001740
4-(2,3-difluorophenyl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 119001740) has the molecular formula C12H7F5N2 and a molecular weight of 274.19 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 4-(2,3-difluorophenyl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 119001740 |
| Molecular Formula | C12H7F5N2 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-(2,3-difluorophenyl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(-c2cccc(F)c2F)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H7F5N2/c13-9-3-1-2-6(11(9)14)7-4-10(18)19-5-8(7)12(15,16)17/h1-5H,(H2,18,19) |
| InChIKey | ZRMFOXRGNLFTFF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |