C12H5F5IN — CID 118819254
2-(2,3-difluorophenyl)-4-iodo-5-(trifluoromethyl)pyridine (PubChem CID 118819254) has the molecular formula C12H5F5IN and a molecular weight of 385.07 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-4-iodo-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(2,3-difluorophenyl)-4-iodo-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 118819254 |
| Molecular Formula | C12H5F5IN |
| Molecular Weight | 385.07 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 2-(2,3-difluorophenyl)-4-iodo-5-(trifluoromethyl)pyridine |
| SMILES | Fc1cccc(-c2cc(I)c(C(F)(F)F)cn2)c1F |
| InChI | InChI=1S/C12H5F5IN/c13-8-3-1-2-6(11(8)14)10-4-9(18)7(5-19-10)12(15,16)17/h1-5H |
| InChIKey | RNLAMDDOIHVMAU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.07 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|