C14H28N+ — CID 123341269
5-ethyl-1,2-dimethyl-1-prop-1-enylazocan-1-ium (PubChem CID 123341269) has the molecular formula C14H28N+ and a molecular weight of 210.38 g/mol. Its IUPAC name is 5-ethyl-1,2-dimethyl-1-prop-1-enylazocan-1-ium.
| Compound Name | 5-ethyl-1,2-dimethyl-1-prop-1-enylazocan-1-ium |
|---|---|
| PubChem CID | 123341269 |
| Molecular Formula | C14H28N+ |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | 5-ethyl-1,2-dimethyl-1-prop-1-enylazocan-1-ium |
| SMILES | CC=C[N+]1(C)CCCC(CC)CCC1C |
| InChI | InChI=1S/C14H28N/c1-5-11-15(4)12-7-8-14(6-2)10-9-13(15)3/h5,11,13-14H,6-10,12H2,1-4H3/q+1 |
| InChIKey | OQRHEZLBXGKBBY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|