C23H25FN4O3 — CID 123342771
1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-[4-(3-fluorophenyl)butyl]pyrrole-2,5-diol (PubChem CID 123342771) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-[4-(3-fluorophenyl)butyl]pyrrole-2,5-diol.
| Compound Name | 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-[4-(3-fluorophenyl)butyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123342771 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-3-[4-(3-fluorophenyl)butyl]pyrrole-2,5-diol |
| SMILES | Cc1noc(C)c1Cn1cc(-n2c(O)cc(CCCCc3cccc(F)c3)c2O)cn1 |
| InChI | InChI=1S/C23H25FN4O3/c1-15-21(16(2)31-26-15)14-27-13-20(12-25-27)28-22(29)11-18(23(28)30)8-4-3-6-17-7-5-9-19(24)10-17/h5,7,9-13,29-30H,3-4,6,8,14H2,1-2H3 |
| InChIKey | DIYACARSYIMILI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|