C20H26FN3O — CID 124834944
4-[[(3aR,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 124834944) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[[(3aR,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[(3aR,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 124834944 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[[(3aR,7aR)-2-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CN1CC[C@H]2CN(Cc3cccc(F)c3)C[C@H]2C1 |
| InChI | InChI=1S/C20H26FN3O/c1-14-20(15(2)25-22-14)13-23-7-6-17-10-24(12-18(17)11-23)9-16-4-3-5-19(21)8-16/h3-5,8,17-18H,6-7,9-13H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | CYQDBDUMEHGQEM-ZWKOTPCHSA-N |
| XLogP | 3.38 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |