C34H29F5O9S2 — CID 123343072
[1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 123343072) has the molecular formula C34H29F5O9S2 and a molecular weight of 740.72 g/mol. Its IUPAC name is [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 123343072 |
| Molecular Formula | C34H29F5O9S2 |
| Molecular Weight | 740.72 g/mol |
| Exact Mass | 740.12 |
| IUPAC Name | [1-[dihydroxy-oxo-(5-phenyldibenzothiophen-5-yl)-λ6-sulfanyl]-1,1,3,3,3-pentafluoropropan-2-yl] 2-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(O)(O)S1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H29F5O9S2/c1-17(2)29(40)46-27-22-16-21-25(30(41)47-28(21)27)26(22)31(42)48-32(33(35,36)37)34(38,39)50(43,44,45)49(18-10-4-3-5-11-18)23-14-8-6-12-19(23)20-13-7-9-15-24(20)49/h3-15,21-22,25-28,32H,1,16H2,2H3,(H2,43,44,45) |
| InChIKey | ZZFAMSTZXZCWAL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|