C9H9FN2S — CID 123344086
5-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 123344086) has the molecular formula C9H9FN2S and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123344086 |
| Molecular Formula | C9H9FN2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-(4-fluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | NC1=NCC(c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C9H9FN2S/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-4,8H,5H2,(H2,11,12) |
| InChIKey | MBQYJRSYBRNFNU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |