C22H22FN3O4S — CID 123345031
4-(amino-methylidene-oxo-λ6-sulfanyl)-15-fluoro-18-methyl-8,11,19-trioxa-22-azatetracyclo[18.3.1.02,7.012,17]tetracosa-1(24),2(7),3,5,12(17),13,15,20,22-nonaen-21-amine (PubChem CID 123345031) has the molecular formula C22H22FN3O4S and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-(amino-methylidene-oxo-λ6-sulfanyl)-15-fluoro-18-methyl-8,11,19-trioxa-22-azatetracyclo[18.3.1.02,7.012,17]tetracosa-1(24),2(7),3,5,12(17),13,15,20,22-nonaen-21-amine.
| Compound Name | 4-(amino-methylidene-oxo-λ6-sulfanyl)-15-fluoro-18-methyl-8,11,19-trioxa-22-azatetracyclo[18.3.1.02,7.012,17]tetracosa-1(24),2(7),3,5,12(17),13,15,20,22-nonaen-21-amine |
|---|---|
| PubChem CID | 123345031 |
| Molecular Formula | C22H22FN3O4S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-(amino-methylidene-oxo-λ6-sulfanyl)-15-fluoro-18-methyl-8,11,19-trioxa-22-azatetracyclo[18.3.1.02,7.012,17]tetracosa-1(24),2(7),3,5,12(17),13,15,20,22-nonaen-21-amine |
| SMILES | C=S(N)(=O)c1ccc2c(c1)-c1cnc(N)c(c1)OC(C)c1cc(F)ccc1OCCO2 |
| InChI | InChI=1S/C22H22FN3O4S/c1-13-17-10-15(23)3-5-19(17)28-7-8-29-20-6-4-16(31(2,25)27)11-18(20)14-9-21(30-13)22(24)26-12-14/h3-6,9-13H,2,7-8H2,1H3,(H2,24,26)(H2,25,27) |
| InChIKey | XQOGCTBFFAJWTF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|