C25H26FN5O2 — CID 171529465
(3R,17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-3-methyl-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one (PubChem CID 171529465) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is (3R,17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-3-methyl-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one.
| Compound Name | (3R,17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-3-methyl-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one |
|---|---|
| PubChem CID | 171529465 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (3R,17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-3-methyl-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one |
| SMILES | CC/N=C1C(=C(/C)N)/C(=O)C2=C(NCC=C2)c2ccc(F)cc2[C@@H](C)Oc2cc/1cnc2N |
| InChI | InChI=1S/C25H26FN5O2/c1-4-29-22-15-10-20(25(28)31-12-15)33-14(3)19-11-16(26)7-8-17(19)23-18(6-5-9-30-23)24(32)21(22)13(2)27/h5-8,10-12,14,30H,4,9,27H2,1-3H3,(H2,28,31)/b21-13+,29-22+/t14-/m1/s1 |
| InChIKey | NNUOPSIARXZMGM-DPXOONKKSA-N |
| XLogP | 3.44 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|