C25H23FN6O2 — CID 171529358
23-amino-17-fluoro-5-methyl-7-oxo-21-oxa-4,5,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2(6),3,8(13),9,14(19),15,17,22,24-decaene-3-carbonitrile;ethane (PubChem CID 171529358) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 23-amino-17-fluoro-5-methyl-7-oxo-21-oxa-4,5,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2(6),3,8(13),9,14(19),15,17,22,24-decaene-3-carbonitrile;ethane.
| Compound Name | 23-amino-17-fluoro-5-methyl-7-oxo-21-oxa-4,5,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2(6),3,8(13),9,14(19),15,17,22,24-decaene-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 171529358 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 23-amino-17-fluoro-5-methyl-7-oxo-21-oxa-4,5,12,24-tetrazapentacyclo[20.3.1.02,6.08,13.014,19]hexacosa-1(26),2(6),3,8(13),9,14(19),15,17,22,24-decaene-3-carbonitrile;ethane |
| SMILES | CC.Cn1nc(C#N)c2c1C(=O)C1=C(NCC=C1)c1ccc(F)cc1COc1cc-2cnc1N |
| InChI | InChI=1S/C23H17FN6O2.C2H6/c1-30-21-19(17(9-25)29-30)12-8-18(23(26)28-10-12)32-11-13-7-14(24)4-5-15(13)20-16(22(21)31)3-2-6-27-20;1-2/h2-5,7-8,10,27H,6,11H2,1H3,(H2,26,28);1-2H3 |
| InChIKey | VHUDINNPQMZUIG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|