C23H24ClFN6O — CID 176959074
(8Z)-5-chloro-3-ethyl-13-fluoro-16-methyl-8-(methyliminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,8,10(15),11,13,18,20-nonaene-9,19-diamine (PubChem CID 176959074) has the molecular formula C23H24ClFN6O and a molecular weight of 454.94 g/mol. Its IUPAC name is (8Z)-5-chloro-3-ethyl-13-fluoro-16-methyl-8-(methyliminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,8,10(15),11,13,18,20-nonaene-9,19-diamine.
| Compound Name | (8Z)-5-chloro-3-ethyl-13-fluoro-16-methyl-8-(methyliminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,8,10(15),11,13,18,20-nonaene-9,19-diamine |
|---|---|
| PubChem CID | 176959074 |
| Molecular Formula | C23H24ClFN6O |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (8Z)-5-chloro-3-ethyl-13-fluoro-16-methyl-8-(methyliminomethyl)-17-oxa-3,4,20-triazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),4,8,10(15),11,13,18,20-nonaene-9,19-diamine |
| SMILES | CCn1nc(Cl)c2c1-c1cnc(N)c(c1)OC(C)c1cc(F)ccc1/C(N)=C(/C=N/C)C2 |
| InChI | InChI=1S/C23H24ClFN6O/c1-4-31-21-14-8-19(23(27)29-11-14)32-12(2)17-9-15(25)5-6-16(17)20(26)13(10-28-3)7-18(21)22(24)30-31/h5-6,8-12H,4,7,26H2,1-3H3,(H2,27,29)/b20-13-,28-10+ |
| InChIKey | JCGGWWDQXAIHQP-WRWQGQLASA-N |
| XLogP | 4.41 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|