C23H20B2ClFN6O2 — CID 176958999
CID 176958999 (PubChem CID 176958999) has the molecular formula C23H20B2ClFN6O2 and a molecular weight of 488.53 g/mol.
| Compound Name | CID 176958999 |
|---|---|
| PubChem CID | 176958999 |
| Molecular Formula | C23H20B2ClFN6O2 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)Cn1nc(Cl)c2c1-c1cnc(N)c(c1)O[C@H](C)c1cc(F)ccc1-c1nn(C)cc1C2 |
| InChI | InChI=1S/C23H20B2ClFN6O2/c1-11-16-7-14(27)3-4-15(16)19-13(9-32(2)30-19)5-17-20(12-6-18(35-11)22(28)29-8-12)33(31-21(17)26)10-23(24,25)34/h3-4,6-9,11,34H,5,10H2,1-2H3,(H2,28,29)/t11-/m1/s1 |
| InChIKey | LKUZVZCIAZNYQE-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|