C26H31F3N2O4 — CID 123345167
2-[3-butyl-5-[(4-methylphenyl)carbamoylamino]-4-(4,4,4-trifluorobutoxy)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 123345167) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-[3-butyl-5-[(4-methylphenyl)carbamoylamino]-4-(4,4,4-trifluorobutoxy)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[3-butyl-5-[(4-methylphenyl)carbamoylamino]-4-(4,4,4-trifluorobutoxy)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123345167 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[3-butyl-5-[(4-methylphenyl)carbamoylamino]-4-(4,4,4-trifluorobutoxy)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCc1cc(C2CC2C(=O)O)cc(NC(=O)Nc2ccc(C)cc2)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C26H31F3N2O4/c1-3-4-6-17-13-18(20-15-21(20)24(32)33)14-22(23(17)35-12-5-11-26(27,28)29)31-25(34)30-19-9-7-16(2)8-10-19/h7-10,13-14,20-21H,3-6,11-12,15H2,1-2H3,(H,32,33)(H2,30,31,34) |
| InChIKey | BLECCTOZGXUKMD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|