C28H29FN2O4 — CID 86764315
2-[3-[(E)-but-2-enyl]-5-[(4-methylphenyl)carbamoylamino]-4-propoxyphenyl]-4-fluorobenzoic acid (PubChem CID 86764315) has the molecular formula C28H29FN2O4 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[3-[(E)-but-2-enyl]-5-[(4-methylphenyl)carbamoylamino]-4-propoxyphenyl]-4-fluorobenzoic acid.
| Compound Name | 2-[3-[(E)-but-2-enyl]-5-[(4-methylphenyl)carbamoylamino]-4-propoxyphenyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 86764315 |
| Molecular Formula | C28H29FN2O4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[3-[(E)-but-2-enyl]-5-[(4-methylphenyl)carbamoylamino]-4-propoxyphenyl]-4-fluorobenzoic acid |
| SMILES | C/C=C/Cc1cc(-c2cc(F)ccc2C(=O)O)cc(NC(=O)Nc2ccc(C)cc2)c1OCCC |
| InChI | InChI=1S/C28H29FN2O4/c1-4-6-7-19-15-20(24-17-21(29)10-13-23(24)27(32)33)16-25(26(19)35-14-5-2)31-28(34)30-22-11-8-18(3)9-12-22/h4,6,8-13,15-17H,5,7,14H2,1-3H3,(H,32,33)(H2,30,31,34)/b6-4+ |
| InChIKey | JLJMMJFUJFHNMA-GQCTYLIASA-N |
| XLogP | 7.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|