C13H16N2O5 — CID 123345174
4-O-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] 1-O-methyl but-2-enedioate (PubChem CID 123345174) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-O-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 123345174 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-O-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCn1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C13H16N2O5/c1-9-8-10(2)15(13(18)14-9)6-7-20-12(17)5-4-11(16)19-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | CTHLUBFIOHLPHO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|