About dipentoxy(propyl)silane
dipentoxy(propyl)silane (PubChem CID 123345702) has the molecular formula C13H30O2Si
and a molecular weight of 246.47 g/mol. Its IUPAC name is dipentoxy(propyl)silane.
Molecular Properties
| Compound Name | dipentoxy(propyl)silane |
| PubChem CID | 123345702 |
| Molecular Formula | C13H30O2Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | dipentoxy(propyl)silane |
| SMILES | CCCCCO[SiH](CCC)OCCCCC |
| InChI | InChI=1S/C13H30O2Si/c1-4-7-9-11-14-16(13-6-3)15-12-10-8-5-2/h16H,4-13H2,1-3H3 |
| InChIKey | GVIRNLPCTJKMAW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipentoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipentoxy(propyl)silane?
The IUPAC name of dipentoxy(propyl)silane (CID 123345702) is dipentoxy(propyl)silane.
What is the SMILES notation for dipentoxy(propyl)silane?
The canonical SMILES for dipentoxy(propyl)silane is CCCCCO[SiH](CCC)OCCCCC.
What is the InChIKey of dipentoxy(propyl)silane?
The InChIKey is GVIRNLPCTJKMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O2Si/c1-4-7-9-11-14-16(13-6-3)15-12-10-8-5-2/h16H,4-13H2,1-3H3.
What are the key properties of dipentoxy(propyl)silane?
dipentoxy(propyl)silane has a molecular weight of 246.47 g/mol, XLogP of 4.03, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipentoxy(propyl)silane is sourced from PubChem (CID 123345702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).