About isocyanic acid;pentyl(dipropoxy)silane
isocyanic acid;pentyl(dipropoxy)silane (PubChem CID 172700048) has the molecular formula C12H27NO3Si
and a molecular weight of 261.44 g/mol. Its IUPAC name is isocyanic acid;pentyl(dipropoxy)silane.
Molecular Properties
| Compound Name | isocyanic acid;pentyl(dipropoxy)silane |
| PubChem CID | 172700048 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | isocyanic acid;pentyl(dipropoxy)silane |
| SMILES | CCCCC[SiH](OCCC)OCCC.N=C=O |
| InChI | InChI=1S/C11H26O2Si.CHNO/c1-4-7-8-11-14(12-9-5-2)13-10-6-3;2-1-3/h14H,4-11H2,1-3H3;2H |
| InChIKey | CVLHLVLVXFLMSA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;pentyl(dipropoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;pentyl(dipropoxy)silane?
The IUPAC name of isocyanic acid;pentyl(dipropoxy)silane (CID 172700048) is isocyanic acid;pentyl(dipropoxy)silane.
What is the SMILES notation for isocyanic acid;pentyl(dipropoxy)silane?
The canonical SMILES for isocyanic acid;pentyl(dipropoxy)silane is CCCCC[SiH](OCCC)OCCC.N=C=O.
What is the InChIKey of isocyanic acid;pentyl(dipropoxy)silane?
The InChIKey is CVLHLVLVXFLMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26O2Si.CHNO/c1-4-7-8-11-14(12-9-5-2)13-10-6-3;2-1-3/h14H,4-11H2,1-3H3;2H.
What are the key properties of isocyanic acid;pentyl(dipropoxy)silane?
isocyanic acid;pentyl(dipropoxy)silane has a molecular weight of 261.44 g/mol, XLogP of 3.15, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;pentyl(dipropoxy)silane is sourced from PubChem (CID 172700048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).