C45H58O5S — CID 123345726
5-[2-tert-butyl-5-[1-(4-tert-butylphenyl)ethyl]phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]carbonylbenzenesulfonic acid (PubChem CID 123345726) has the molecular formula C45H58O5S and a molecular weight of 711.02 g/mol. Its IUPAC name is 5-[2-tert-butyl-5-[1-(4-tert-butylphenyl)ethyl]phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]carbonylbenzenesulfonic acid.
| Compound Name | 5-[2-tert-butyl-5-[1-(4-tert-butylphenyl)ethyl]phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]carbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 123345726 |
| Molecular Formula | C45H58O5S |
| Molecular Weight | 711.02 g/mol |
| Exact Mass | 710.40 |
| IUPAC Name | 5-[2-tert-butyl-5-[1-(4-tert-butylphenyl)ethyl]phenyl]-2-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]carbonylbenzenesulfonic acid |
| SMILES | CC(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)c(-c2ccc(C(=O)Oc3ccc(C(CC(C)(C)C)C(C)(C)C)cc3)c(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C45H58O5S/c1-29(30-14-20-34(21-15-30)43(5,6)7)32-19-25-38(44(8,9)10)37(26-32)33-18-24-36(40(27-33)51(47,48)49)41(46)50-35-22-16-31(17-23-35)39(45(11,12)13)28-42(2,3)4/h14-27,29,39H,28H2,1-13H3,(H,47,48,49) |
| InChIKey | GGQBRSAIQREVTN-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.02 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|