C5H8N2 — CID 123346394
(Z)-4-N-methylidenebut-3-ene-2,4-diimine (PubChem CID 123346394) has the molecular formula C5H8N2 and a molecular weight of 96.13 g/mol. Its IUPAC name is (Z)-4-N-methylidenebut-3-ene-2,4-diimine.
| Compound Name | (Z)-4-N-methylidenebut-3-ene-2,4-diimine |
|---|---|
| PubChem CID | 123346394 |
| Molecular Formula | C5H8N2 |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | (Z)-4-N-methylidenebut-3-ene-2,4-diimine |
| SMILES | [H]/N=C(C)/C=C\N=C |
| InChI | InChI=1S/C5H8N2/c1-5(6)3-4-7-2/h3-4,6H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | GYVWANAYHBLUAH-DNVGVPOPSA-N |
| XLogP | 1.24 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|