C28H38N3O4P — CID 123346830
3-diethoxyphosphoryl-1-[8-(3-tricyclo[3.3.1.03,7]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one (PubChem CID 123346830) has the molecular formula C28H38N3O4P and a molecular weight of 511.60 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1-[8-(3-tricyclo[3.3.1.03,7]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one.
| Compound Name | 3-diethoxyphosphoryl-1-[8-(3-tricyclo[3.3.1.03,7]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one |
|---|---|
| PubChem CID | 123346830 |
| Molecular Formula | C28H38N3O4P |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 3-diethoxyphosphoryl-1-[8-(3-tricyclo[3.3.1.03,7]nonanyl)-8-azabicyclo[3.2.1]octan-3-yl]quinoxalin-2-one |
| SMILES | CCOP(=O)(OCC)c1nc2ccccc2n(C2CC3CCC(C2)N3C23CC4CC(CC2C4)C3)c1=O |
| InChI | InChI=1S/C28H38N3O4P/c1-3-34-36(33,35-4-2)26-27(32)30(25-8-6-5-7-24(25)29-26)23-14-21-9-10-22(15-23)31(21)28-16-18-11-19(17-28)13-20(28)12-18/h5-8,18-23H,3-4,9-17H2,1-2H3 |
| InChIKey | CVBWYFBEARUZOC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|