C14H10ClN5O2 — CID 123348623
2-(3-chlorophenyl)imidazo[1,2-a]pyrimidine-3,7-dicarboxamide (PubChem CID 123348623) has the molecular formula C14H10ClN5O2 and a molecular weight of 315.72 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidine-3,7-dicarboxamide.
| Compound Name | 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidine-3,7-dicarboxamide |
|---|---|
| PubChem CID | 123348623 |
| Molecular Formula | C14H10ClN5O2 |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidine-3,7-dicarboxamide |
| SMILES | NC(=O)c1ccn2c(C(N)=O)c(-c3cccc(Cl)c3)nc2n1 |
| InChI | InChI=1S/C14H10ClN5O2/c15-8-3-1-2-7(6-8)10-11(13(17)22)20-5-4-9(12(16)21)18-14(20)19-10/h1-6H,(H2,16,21)(H2,17,22) |
| InChIKey | JSKUSKFBXNTPLP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |