C21H25NO5 — CID 123350306
ethyl 3-(3-ethoxy-3-oxopropyl)-5-methyl-4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate (PubChem CID 123350306) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is ethyl 3-(3-ethoxy-3-oxopropyl)-5-methyl-4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-(3-ethoxy-3-oxopropyl)-5-methyl-4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 123350306 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl 3-(3-ethoxy-3-oxopropyl)-5-methyl-4-(2-phenylacetyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)CCc1c(C(=O)OCC)[nH]c(C)c1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c1-4-26-18(24)12-11-16-19(14(3)22-20(16)21(25)27-5-2)17(23)13-15-9-7-6-8-10-15/h6-10,22H,4-5,11-13H2,1-3H3 |
| InChIKey | VYBADLVTPUYZLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |