C9H18N2O — CID 123351483
4-(methoxymethyl)heptane-2,5-diimine (PubChem CID 123351483) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-(methoxymethyl)heptane-2,5-diimine.
| Compound Name | 4-(methoxymethyl)heptane-2,5-diimine |
|---|---|
| PubChem CID | 123351483 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-(methoxymethyl)heptane-2,5-diimine |
| SMILES | [H]/N=C(\C)CC(COC)/C(CC)=N/[H] |
| InChI | InChI=1S/C9H18N2O/c1-4-9(11)8(6-12-3)5-7(2)10/h8,10-11H,4-6H2,1-3H3/b10-7+,11-9+ |
| InChIKey | RFHXKSXFNQHIKO-PPZOTWNKSA-N |
| XLogP | 2.11 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|