C21H37N4+ — CID 123353382
5-[[1-(1-butan-2-yl-2-pyridinylidene)-1-(methylideneamino)propan-2-ylidene]amino]pentyl-trimethylazanium (PubChem CID 123353382) has the molecular formula C21H37N4+ and a molecular weight of 345.56 g/mol. Its IUPAC name is 5-[[1-(1-butan-2-yl-2-pyridinylidene)-1-(methylideneamino)propan-2-ylidene]amino]pentyl-trimethylazanium.
| Compound Name | 5-[[1-(1-butan-2-yl-2-pyridinylidene)-1-(methylideneamino)propan-2-ylidene]amino]pentyl-trimethylazanium |
|---|---|
| PubChem CID | 123353382 |
| Molecular Formula | C21H37N4+ |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 5-[[1-(1-butan-2-yl-2-pyridinylidene)-1-(methylideneamino)propan-2-ylidene]amino]pentyl-trimethylazanium |
| SMILES | C=NC(=C1C=CC=CN1C(C)CC)/C(C)=N/CCCCC[N+](C)(C)C |
| InChI | InChI=1S/C21H37N4/c1-8-18(2)24-16-12-10-14-20(24)21(22-4)19(3)23-15-11-9-13-17-25(5,6)7/h10,12,14,16,18H,4,8-9,11,13,15,17H2,1-3,5-7H3/q+1/b21-20?,23-19+ |
| InChIKey | YDPKZPZQBLWRRH-DJFICNOQSA-N |
| XLogP | 4.42 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|