C20H36N2 — CID 177055261
N-[(2S)-pentan-2-yl]-N-[(3Z)-4-(propan-2-ylideneamino)hexa-1,3-dien-2-yl]cyclohexanamine (PubChem CID 177055261) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N-[(2S)-pentan-2-yl]-N-[(3Z)-4-(propan-2-ylideneamino)hexa-1,3-dien-2-yl]cyclohexanamine.
| Compound Name | N-[(2S)-pentan-2-yl]-N-[(3Z)-4-(propan-2-ylideneamino)hexa-1,3-dien-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 177055261 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N-[(2S)-pentan-2-yl]-N-[(3Z)-4-(propan-2-ylideneamino)hexa-1,3-dien-2-yl]cyclohexanamine |
| SMILES | C=C(/C=C(/CC)N=C(C)C)N(C1CCCCC1)[C@@H](C)CCC |
| InChI | InChI=1S/C20H36N2/c1-7-12-17(5)22(20-13-10-9-11-14-20)18(6)15-19(8-2)21-16(3)4/h15,17,20H,6-14H2,1-5H3/b19-15-/t17-/m0/s1 |
| InChIKey | AHMJYMBDLBFOJX-STZPCZCHSA-N |
| XLogP | 6.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|