C20H38N2 — CID 177055367
ethane;N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine (PubChem CID 177055367) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is ethane;N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine.
| Compound Name | ethane;N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine |
|---|---|
| PubChem CID | 177055367 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | ethane;N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine |
| SMILES | C=C(C)CN(C/C=C(/CC)N=C(C)C)C1CCCCC1.CC |
| InChI | InChI=1S/C18H32N2.C2H6/c1-6-17(19-16(4)5)12-13-20(14-15(2)3)18-10-8-7-9-11-18;1-2/h12,18H,2,6-11,13-14H2,1,3-5H3;1-2H3/b17-12-; |
| InChIKey | JVXHWVCMTJWWBD-HBPAQXCTSA-N |
| XLogP | 6.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|