C23H42N2 — CID 143467546
(2E)-1-N,7-N-dicyclohexyl-1-N,7-N,2-trimethylocta-2,7-diene-1,7-diamine (PubChem CID 143467546) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is (2E)-1-N,7-N-dicyclohexyl-1-N,7-N,2-trimethylocta-2,7-diene-1,7-diamine.
| Compound Name | (2E)-1-N,7-N-dicyclohexyl-1-N,7-N,2-trimethylocta-2,7-diene-1,7-diamine |
|---|---|
| PubChem CID | 143467546 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | (2E)-1-N,7-N-dicyclohexyl-1-N,7-N,2-trimethylocta-2,7-diene-1,7-diamine |
| SMILES | C=C(CCC/C=C(\C)CN(C)C1CCCCC1)N(C)C1CCCCC1 |
| InChI | InChI=1S/C23H42N2/c1-20(19-24(3)22-15-7-5-8-16-22)13-11-12-14-21(2)25(4)23-17-9-6-10-18-23/h13,22-23H,2,5-12,14-19H2,1,3-4H3/b20-13+ |
| InChIKey | OLBGCHIJHARCJY-DEDYPNTBSA-N |
| XLogP | 6.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|