C18H32N2 — CID 177055368
N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine (PubChem CID 177055368) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine.
| Compound Name | N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine |
|---|---|
| PubChem CID | 177055368 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N-(2-methylprop-2-enyl)-N-[(Z)-3-(propan-2-ylideneamino)pent-2-enyl]cyclohexanamine |
| SMILES | C=C(C)CN(C/C=C(/CC)N=C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C18H32N2/c1-6-17(19-16(4)5)12-13-20(14-15(2)3)18-10-8-7-9-11-18/h12,18H,2,6-11,13-14H2,1,3-5H3/b17-12- |
| InChIKey | DIEZHEGIXRZKSN-ATVHPVEESA-N |
| XLogP | 4.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|