C18H35N3 — CID 143378330
N-[(Z)-4-(4-hexylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine (PubChem CID 143378330) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[(Z)-4-(4-hexylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine.
| Compound Name | N-[(Z)-4-(4-hexylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 143378330 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | N-[(Z)-4-(4-hexylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine |
| SMILES | CCCCCCN1CCN(C(C)/C=C(/C)N=C(C)C)CC1 |
| InChI | InChI=1S/C18H35N3/c1-6-7-8-9-10-20-11-13-21(14-12-20)18(5)15-17(4)19-16(2)3/h15,18H,6-14H2,1-5H3/b17-15- |
| InChIKey | IVEUSVAYCLJBEQ-ICFOKQHNSA-N |
| XLogP | 3.96 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|