About ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine
ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine (PubChem CID 143378415) has the molecular formula C20H47N3
and a molecular weight of 329.62 g/mol. Its IUPAC name is ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine.
Molecular Properties
| Compound Name | ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine |
| PubChem CID | 143378415 |
| Molecular Formula | C20H47N3 |
| Molecular Weight | 329.62 g/mol |
| Exact Mass | 329.38 |
| IUPAC Name | ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine |
| SMILES | C.C.C.CC.CCCN1CCN(C(C)/C=C(/C)N=C(C)C)CC1 |
| InChI | InChI=1S/C15H29N3.C2H6.3CH4/c1-6-7-17-8-10-18(11-9-17)15(5)12-14(4)16-13(2)3;1-2;;;/h12,15H,6-11H2,1-5H3;1-2H3;3*1H4/b14-12-;;;; |
| InChIKey | LESYMPJUFWOVHM-BIPGZBTMSA-N |
| XLogP | 5.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine?
The IUPAC name of ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine (CID 143378415) is ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine.
What is the SMILES notation for ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine?
The canonical SMILES for ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine is C.C.C.CC.CCCN1CCN(C(C)/C=C(/C)N=C(C)C)CC1.
What is the InChIKey of ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine?
The InChIKey is LESYMPJUFWOVHM-BIPGZBTMSA-N. The full InChI is InChI=1S/C15H29N3.C2H6.3CH4/c1-6-7-17-8-10-18(11-9-17)15(5)12-14(4)16-13(2)3;1-2;;;/h12,15H,6-11H2,1-5H3;1-2H3;3*1H4/b14-12-;;;;.
What are the key properties of ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine?
ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine has a molecular weight of 329.62 g/mol, XLogP of 5.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;N-[(Z)-4-(4-propylpiperazin-1-yl)pent-2-en-2-yl]propan-2-imine is sourced from PubChem (CID 143378415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).