C19H35N3 — CID 138642665
(2Z,5Z)-1-N,1-N-dimethyl-4-methylidene-2-(propan-2-ylideneamino)-5-N,5-N-dipropylhepta-2,5-diene-1,5-diamine (PubChem CID 138642665) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is (2Z,5Z)-1-N,1-N-dimethyl-4-methylidene-2-(propan-2-ylideneamino)-5-N,5-N-dipropylhepta-2,5-diene-1,5-diamine.
| Compound Name | (2Z,5Z)-1-N,1-N-dimethyl-4-methylidene-2-(propan-2-ylideneamino)-5-N,5-N-dipropylhepta-2,5-diene-1,5-diamine |
|---|---|
| PubChem CID | 138642665 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | (2Z,5Z)-1-N,1-N-dimethyl-4-methylidene-2-(propan-2-ylideneamino)-5-N,5-N-dipropylhepta-2,5-diene-1,5-diamine |
| SMILES | C=C(/C=C(\CN(C)C)N=C(C)C)/C(=C/C)N(CCC)CCC |
| InChI | InChI=1S/C19H35N3/c1-9-12-22(13-10-2)19(11-3)17(6)14-18(15-21(7)8)20-16(4)5/h11,14H,6,9-10,12-13,15H2,1-5,7-8H3/b18-14-,19-11- |
| InChIKey | VQUIWRSWNYHCBR-WCOXTVFRSA-N |
| XLogP | 4.49 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|