C26H47N3 — CID 143280735
3-(3-butyl-4-heptan-4-ylpiperazin-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]but-3-en-2-imine (PubChem CID 143280735) has the molecular formula C26H47N3 and a molecular weight of 401.68 g/mol. Its IUPAC name is 3-(3-butyl-4-heptan-4-ylpiperazin-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]but-3-en-2-imine.
| Compound Name | 3-(3-butyl-4-heptan-4-ylpiperazin-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]but-3-en-2-imine |
|---|---|
| PubChem CID | 143280735 |
| Molecular Formula | C26H47N3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.38 |
| IUPAC Name | 3-(3-butyl-4-heptan-4-ylpiperazin-1-yl)-N-[(Z)-4-methylidenehex-2-en-3-yl]but-3-en-2-imine |
| SMILES | C=C(CC)C(=C/C)/N=C(/C)C(=C)N1CCN(C(CCC)CCC)C(CCCC)C1 |
| InChI | InChI=1S/C26H47N3/c1-9-14-17-25-20-28(18-19-29(25)24(15-10-2)16-11-3)23(8)22(7)27-26(13-5)21(6)12-4/h13,24-25H,6,8-12,14-20H2,1-5,7H3/b26-13-,27-22+ |
| InChIKey | WOBCTDFWIXGSDV-LUWNLXEFSA-N |
| XLogP | 6.98 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|