C22H37N3 — CID 143721682
3-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]imino-N-propylpent-1-en-2-amine (PubChem CID 143721682) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 3-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]imino-N-propylpent-1-en-2-amine.
| Compound Name | 3-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]imino-N-propylpent-1-en-2-amine |
|---|---|
| PubChem CID | 143721682 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 3-[(2E,4Z,6Z)-3-methyl-1-piperidin-1-ylocta-2,4,6-trien-2-yl]imino-N-propylpent-1-en-2-amine |
| SMILES | C=C(NCCC)/C(CC)=N/C(CN1CCCCC1)=C(C)/C=C\C=C/C |
| InChI | InChI=1S/C22H37N3/c1-6-9-11-14-19(4)22(18-25-16-12-10-13-17-25)24-21(8-3)20(5)23-15-7-2/h6,9,11,14,23H,5,7-8,10,12-13,15-18H2,1-4H3/b9-6-,14-11-,22-19+,24-21+ |
| InChIKey | MRYQDSVGBGMQCW-HENBKPJQSA-N |
| XLogP | 5.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|