C29H43FN4 — CID 176691520
(2E,4E,6E)-N-[[(4E)-4-butylidene-6-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-5,7-dimethyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine (PubChem CID 176691520) has the molecular formula C29H43FN4 and a molecular weight of 466.69 g/mol. Its IUPAC name is (2E,4E,6E)-N-[[(4E)-4-butylidene-6-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-5,7-dimethyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4E,6E)-N-[[(4E)-4-butylidene-6-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-5,7-dimethyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176691520 |
| Molecular Formula | C29H43FN4 |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | (2E,4E,6E)-N-[[(4E)-4-butylidene-6-fluoro-3-[(Z)-prop-1-enyl]iminocyclohexa-1,5-dien-1-yl]methyl]-5,7-dimethyl-4-piperazin-1-ylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C\N=C1/C=C(CNC(=C/C)/C(=C(C)\C=C(/C)CC)N2CCNCC2)C(F)=C/C1=C\CCC |
| InChI | InChI=1S/C29H43FN4/c1-7-11-12-24-19-26(30)25(20-28(24)32-13-8-2)21-33-27(10-4)29(23(6)18-22(5)9-3)34-16-14-31-15-17-34/h8,10,12-13,18-20,31,33H,7,9,11,14-17,21H2,1-6H3/b13-8-,22-18+,24-12+,27-10+,29-23+,32-28+ |
| InChIKey | DAEWPCQWTZOFGZ-MJSHOIFMSA-N |
| XLogP | 6.51 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|