C28H39F3N4 — CID 176691438
(2E,4Z,6E)-7-methyl-4-piperazin-1-yl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-5-(trifluoromethyl)nona-2,4,6-trien-3-amine (PubChem CID 176691438) has the molecular formula C28H39F3N4 and a molecular weight of 488.64 g/mol. Its IUPAC name is (2E,4Z,6E)-7-methyl-4-piperazin-1-yl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-5-(trifluoromethyl)nona-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6E)-7-methyl-4-piperazin-1-yl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-5-(trifluoromethyl)nona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176691438 |
| Molecular Formula | C28H39F3N4 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (2E,4Z,6E)-7-methyl-4-piperazin-1-yl-N-[[(4E)-3-[(Z)-prop-1-enyl]imino-4-propylidenecyclohexa-1,5-dien-1-yl]methyl]-5-(trifluoromethyl)nona-2,4,6-trien-3-amine |
| SMILES | C/C=C\N=C1/C=C(CNC(=C/C)/C(=C(\C=C(/C)CC)C(F)(F)F)N2CCNCC2)C=C/C1=C\CC |
| InChI | InChI=1S/C28H39F3N4/c1-6-10-23-12-11-22(19-26(23)33-13-7-2)20-34-25(9-4)27(35-16-14-32-15-17-35)24(28(29,30)31)18-21(5)8-3/h7,9-13,18-19,32,34H,6,8,14-17,20H2,1-5H3/b13-7-,21-18+,23-10+,25-9+,27-24-,33-26+ |
| InChIKey | CLZSGITZTWGNEN-DTQOUCMQSA-N |
| XLogP | 6.36 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|