C16H31N3 — CID 145198032
ethane;2-[(3Z)-3-ethylidene-4-prop-1-en-2-yliminopiperidin-1-yl]-N,N-dimethylethanamine (PubChem CID 145198032) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;2-[(3Z)-3-ethylidene-4-prop-1-en-2-yliminopiperidin-1-yl]-N,N-dimethylethanamine.
| Compound Name | ethane;2-[(3Z)-3-ethylidene-4-prop-1-en-2-yliminopiperidin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 145198032 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | ethane;2-[(3Z)-3-ethylidene-4-prop-1-en-2-yliminopiperidin-1-yl]-N,N-dimethylethanamine |
| SMILES | C=C(C)/N=C1\CCN(CCN(C)C)C\C1=C\C.CC |
| InChI | InChI=1S/C14H25N3.C2H6/c1-6-13-11-17(10-9-16(4)5)8-7-14(13)15-12(2)3;1-2/h6H,2,7-11H2,1,3-5H3;1-2H3/b13-6-,15-14+; |
| InChIKey | FPHGRIJYSAZVGE-PNDDVHAESA-N |
| XLogP | 3.20 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|