C42H66O8 — CID 123353439
(2-hexa-3,5-dien-2-yl-4,14,16-trihydroxy-3,7,9,11,17-pentamethyl-22-oxo-1-oxacyclodocosa-12,18,20-trien-10-yl) 2,4,4-trimethylhex-5-yn-2-yl carbonate (PubChem CID 123353439) has the molecular formula C42H66O8 and a molecular weight of 698.98 g/mol. Its IUPAC name is (2-hexa-3,5-dien-2-yl-4,14,16-trihydroxy-3,7,9,11,17-pentamethyl-22-oxo-1-oxacyclodocosa-12,18,20-trien-10-yl) 2,4,4-trimethylhex-5-yn-2-yl carbonate.
| Compound Name | (2-hexa-3,5-dien-2-yl-4,14,16-trihydroxy-3,7,9,11,17-pentamethyl-22-oxo-1-oxacyclodocosa-12,18,20-trien-10-yl) 2,4,4-trimethylhex-5-yn-2-yl carbonate |
|---|---|
| PubChem CID | 123353439 |
| Molecular Formula | C42H66O8 |
| Molecular Weight | 698.98 g/mol |
| Exact Mass | 698.48 |
| IUPAC Name | (2-hexa-3,5-dien-2-yl-4,14,16-trihydroxy-3,7,9,11,17-pentamethyl-22-oxo-1-oxacyclodocosa-12,18,20-trien-10-yl) 2,4,4-trimethylhex-5-yn-2-yl carbonate |
| SMILES | C#CC(C)(C)CC(C)(C)OC(=O)OC1C(C)C=CC(O)CC(O)C(C)C=CC=CC(=O)OC(C(C)C=CC=C)C(C)C(O)CCC(C)CC1C |
| InChI | InChI=1S/C42H66O8/c1-13-15-18-30(5)39-33(8)35(44)24-21-28(3)25-32(7)38(49-40(47)50-42(11,12)27-41(9,10)14-2)31(6)22-23-34(43)26-36(45)29(4)19-16-17-20-37(46)48-39/h2,13,15-20,22-23,28-36,38-39,43-45H,1,21,24-27H2,3-12H3 |
| InChIKey | FMHYFGFPZTWKMF-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.98 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|