About N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline
N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline (PubChem CID 123354097) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline.
Molecular Properties
| Compound Name | N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline |
| PubChem CID | 123354097 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline |
| SMILES | CC(C)(C)N(c1ccccc1)S(C)(C)C |
| InChI | InChI=1S/C13H23NS/c1-13(2,3)14(15(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3 |
| InChIKey | BHHSDUKVZFYAGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline?
The IUPAC name of N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline (CID 123354097) is N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline.
What is the SMILES notation for N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline?
The canonical SMILES for N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline is CC(C)(C)N(c1ccccc1)S(C)(C)C.
What is the InChIKey of N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline?
The InChIKey is BHHSDUKVZFYAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS/c1-13(2,3)14(15(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3.
What are the key properties of N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline?
N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline has a molecular weight of 225.40 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-(trimethyl-λ4-sulfanyl)aniline is sourced from PubChem (CID 123354097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).