C9H19N3O2 — CID 123354584
tert-butyl N-(2-amino-2-ethyliminoethyl)carbamate (PubChem CID 123354584) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl N-(2-amino-2-ethyliminoethyl)carbamate.
| Compound Name | tert-butyl N-(2-amino-2-ethyliminoethyl)carbamate |
|---|---|
| PubChem CID | 123354584 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | tert-butyl N-(2-amino-2-ethyliminoethyl)carbamate |
| SMILES | CC/N=C(\N)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19N3O2/c1-5-11-7(10)6-12-8(13)14-9(2,3)4/h5-6H2,1-4H3,(H2,10,11)(H,12,13) |
| InChIKey | WCQMSNZEKHQUTB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|