C15H22N4O — CID 123357809
1-[4-(methylamino)-6-[2-(methyldiazenyl)ethyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 123357809) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-[4-(methylamino)-6-[2-(methyldiazenyl)ethyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[4-(methylamino)-6-[2-(methyldiazenyl)ethyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 123357809 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-[4-(methylamino)-6-[2-(methyldiazenyl)ethyl]-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | C/N=N/CCc1ccc2c(c1)C(NC)CCN2C(C)=O |
| InChI | InChI=1S/C15H22N4O/c1-11(20)19-9-7-14(16-2)13-10-12(4-5-15(13)19)6-8-18-17-3/h4-5,10,14,16H,6-9H2,1-3H3/b18-17+ |
| InChIKey | MPMLOMBGCTVLJA-ISLYRVAYSA-N |
| XLogP | 2.33 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|