C27H29N3O4 — CID 142307123
N-(1-acetyl-6-phenoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(2-amino-4-hydroxy-6-methylphenyl)propanamide (PubChem CID 142307123) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-(1-acetyl-6-phenoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(2-amino-4-hydroxy-6-methylphenyl)propanamide.
| Compound Name | N-(1-acetyl-6-phenoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(2-amino-4-hydroxy-6-methylphenyl)propanamide |
|---|---|
| PubChem CID | 142307123 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-(1-acetyl-6-phenoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(2-amino-4-hydroxy-6-methylphenyl)propanamide |
| SMILES | CC(=O)N1CCC(NC(=O)CCc2c(C)cc(O)cc2N)c2cc(Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C27H29N3O4/c1-17-14-19(32)15-24(28)22(17)9-11-27(33)29-25-12-13-30(18(2)31)26-10-8-21(16-23(25)26)34-20-6-4-3-5-7-20/h3-8,10,14-16,25,32H,9,11-13,28H2,1-2H3,(H,29,33) |
| InChIKey | OUDFVRXYKVMHRD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|